C11H11N3O3S — CID 79154501
2-(dimethylcarbamoylamino)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 79154501) has the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-(dimethylcarbamoylamino)-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-(dimethylcarbamoylamino)-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 79154501 |
| Molecular Formula | C11H11N3O3S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-(dimethylcarbamoylamino)-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CN(C)C(=O)Nc1nc2ccc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C11H11N3O3S/c1-14(2)11(17)13-10-12-7-4-3-6(9(15)16)5-8(7)18-10/h3-5H,1-2H3,(H,15,16)(H,12,13,17) |
| InChIKey | HWXRJBMXXCKKDC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |