C10H9N3O2S — CID 816956
2-acetamido-1,3-benzothiazole-6-carboxamide (PubChem CID 816956) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is 2-acetamido-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-acetamido-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 816956 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2-acetamido-1,3-benzothiazole-6-carboxamide |
| SMILES | CC(=O)Nc1nc2ccc(C(N)=O)cc2s1 |
| InChI | InChI=1S/C10H9N3O2S/c1-5(14)12-10-13-7-3-2-6(9(11)15)4-8(7)16-10/h2-4H,1H3,(H2,11,15)(H,12,13,14) |
| InChIKey | JYKFJDOJASDJSM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |