C12H13N2OSW- — CID 59896475
N-(6-propyl-1,3-benzothiazol-2-yl)acetamide;tungsten (PubChem CID 59896475) has the molecular formula C12H13N2OSW- and a molecular weight of 417.16 g/mol. Its IUPAC name is N-(6-propyl-1,3-benzothiazol-2-yl)acetamide;tungsten.
| Compound Name | N-(6-propyl-1,3-benzothiazol-2-yl)acetamide;tungsten |
|---|---|
| PubChem CID | 59896475 |
| Molecular Formula | C12H13N2OSW- |
| Molecular Weight | 417.16 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | N-(6-propyl-1,3-benzothiazol-2-yl)acetamide;tungsten |
| SMILES | C[CH-]Cc1ccc2nc(NC(C)=O)sc2c1.[W] |
| InChI | InChI=1S/C12H13N2OS.W/c1-3-4-9-5-6-10-11(7-9)16-12(14-10)13-8(2)15;/h3,5-7H,4H2,1-2H3,(H,13,14,15);/q-1; |
| InChIKey | OWJGCBZWWJEQHR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.16 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|