C16H9F3N4O2S — CID 146255052
1-(3-cyanophenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea (PubChem CID 146255052) has the molecular formula C16H9F3N4O2S and a molecular weight of 378.34 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 146255052 |
| Molecular Formula | C16H9F3N4O2S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea |
| SMILES | N#Cc1cccc(NC(=O)Nc2nc3ccc(OC(F)(F)F)cc3s2)c1 |
| InChI | InChI=1S/C16H9F3N4O2S/c17-16(18,19)25-11-4-5-12-13(7-11)26-15(22-12)23-14(24)21-10-3-1-2-9(6-10)8-20/h1-7H,(H2,21,22,23,24) |
| InChIKey | OLCWGRUFVUFSBJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |