C25H29N5O4S — CID 146254975
1-(6-cyano-1,3-benzothiazol-2-yl)-3-[3-[2-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]ethoxy]ethoxy]phenyl]urea (PubChem CID 146254975) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 1-(6-cyano-1,3-benzothiazol-2-yl)-3-[3-[2-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]ethoxy]ethoxy]phenyl]urea.
| Compound Name | 1-(6-cyano-1,3-benzothiazol-2-yl)-3-[3-[2-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]ethoxy]ethoxy]phenyl]urea |
|---|---|
| PubChem CID | 146254975 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 1-(6-cyano-1,3-benzothiazol-2-yl)-3-[3-[2-[2-[1-[(2-methylpropan-2-yl)oxy]ethenylamino]ethoxy]ethoxy]phenyl]urea |
| SMILES | C=C(NCCOCCOc1cccc(NC(=O)Nc2nc3ccc(C#N)cc3s2)c1)OC(C)(C)C |
| InChI | InChI=1S/C25H29N5O4S/c1-17(34-25(2,3)4)27-10-11-32-12-13-33-20-7-5-6-19(15-20)28-23(31)30-24-29-21-9-8-18(16-26)14-22(21)35-24/h5-9,14-15,27H,1,10-13H2,2-4H3,(H2,28,29,30,31) |
| InChIKey | JYBKDLALOWIZHL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|