C13H13N3O2S — CID 137332820
tert-butyl N-(5-cyano-1,3-benzothiazol-2-yl)carbamate (PubChem CID 137332820) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is tert-butyl N-(5-cyano-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-cyano-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 137332820 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | tert-butyl N-(5-cyano-1,3-benzothiazol-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2cc(C#N)ccc2s1 |
| InChI | InChI=1S/C13H13N3O2S/c1-13(2,3)18-12(17)16-11-15-9-6-8(7-14)4-5-10(9)19-11/h4-6H,1-3H3,(H,15,16,17) |
| InChIKey | HDTVFYZNPBDWJU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |