C17H17FN4O2S — CID 168973661
tert-butyl N-[6-[(2-fluoro-4-pyridinyl)amino]-1,3-benzothiazol-2-yl]carbamate (PubChem CID 168973661) has the molecular formula C17H17FN4O2S and a molecular weight of 360.41 g/mol. Its IUPAC name is tert-butyl N-[6-[(2-fluoro-4-pyridinyl)amino]-1,3-benzothiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[6-[(2-fluoro-4-pyridinyl)amino]-1,3-benzothiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 168973661 |
| Molecular Formula | C17H17FN4O2S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | tert-butyl N-[6-[(2-fluoro-4-pyridinyl)amino]-1,3-benzothiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nc2ccc(Nc3ccnc(F)c3)cc2s1 |
| InChI | InChI=1S/C17H17FN4O2S/c1-17(2,3)24-16(23)22-15-21-12-5-4-10(8-13(12)25-15)20-11-6-7-19-14(18)9-11/h4-9H,1-3H3,(H,19,20)(H,21,22,23) |
| InChIKey | NPBGFRYVZHVYRZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|