C16H23N3O2S2 — CID 103821709
tert-butyl N-[3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)amino]propyl]carbamate (PubChem CID 103821709) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 103821709 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | tert-butyl N-[3-[(2-methylsulfanyl-1,3-benzothiazol-6-yl)amino]propyl]carbamate |
| SMILES | CSc1nc2ccc(NCCCNC(=O)OC(C)(C)C)cc2s1 |
| InChI | InChI=1S/C16H23N3O2S2/c1-16(2,3)21-14(20)18-9-5-8-17-11-6-7-12-13(10-11)23-15(19-12)22-4/h6-7,10,17H,5,8-9H2,1-4H3,(H,18,20) |
| InChIKey | HZPVCUFWGIFGBD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|