C15H12N2OS2 — CID 959118
N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)benzamide (PubChem CID 959118) has the molecular formula C15H12N2OS2 and a molecular weight of 300.41 g/mol. Its IUPAC name is N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)benzamide.
| Compound Name | N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)benzamide |
|---|---|
| PubChem CID | 959118 |
| Molecular Formula | C15H12N2OS2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)benzamide |
| SMILES | CSc1nc2ccc(NC(=O)c3ccccc3)cc2s1 |
| InChI | InChI=1S/C15H12N2OS2/c1-19-15-17-12-8-7-11(9-13(12)20-15)16-14(18)10-5-3-2-4-6-10/h2-9H,1H3,(H,16,18) |
| InChIKey | XCNRTFOFVUJVTG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |