C13H9IN2OS3 — CID 79692948
5-iodo-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)thiophene-3-carboxamide (PubChem CID 79692948) has the molecular formula C13H9IN2OS3 and a molecular weight of 432.33 g/mol. Its IUPAC name is 5-iodo-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 79692948 |
| Molecular Formula | C13H9IN2OS3 |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.89 |
| IUPAC Name | 5-iodo-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)thiophene-3-carboxamide |
| SMILES | CSc1nc2ccc(NC(=O)c3csc(I)c3)cc2s1 |
| InChI | InChI=1S/C13H9IN2OS3/c1-18-13-16-9-3-2-8(5-10(9)20-13)15-12(17)7-4-11(14)19-6-7/h2-6H,1H3,(H,15,17) |
| InChIKey | SEIOSNMJRYNDEV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|