C15H10Cl2N2OS2 — CID 43952428
3,5-dichloro-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)benzamide (PubChem CID 43952428) has the molecular formula C15H10Cl2N2OS2 and a molecular weight of 369.30 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)benzamide.
| Compound Name | 3,5-dichloro-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)benzamide |
|---|---|
| PubChem CID | 43952428 |
| Molecular Formula | C15H10Cl2N2OS2 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 3,5-dichloro-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)benzamide |
| SMILES | CSc1nc2ccc(NC(=O)c3cc(Cl)cc(Cl)c3)cc2s1 |
| InChI | InChI=1S/C15H10Cl2N2OS2/c1-21-15-19-12-3-2-11(7-13(12)22-15)18-14(20)8-4-9(16)6-10(17)5-8/h2-7H,1H3,(H,18,20) |
| InChIKey | PFCAVJHHRWBTRV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |