C16H12N4OS2 — CID 26850847
N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-1H-indazole-3-carboxamide (PubChem CID 26850847) has the molecular formula C16H12N4OS2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-1H-indazole-3-carboxamide.
| Compound Name | N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 26850847 |
| Molecular Formula | C16H12N4OS2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-1H-indazole-3-carboxamide |
| SMILES | CSc1nc2ccc(NC(=O)c3n[nH]c4ccccc34)cc2s1 |
| InChI | InChI=1S/C16H12N4OS2/c1-22-16-18-12-7-6-9(8-13(12)23-16)17-15(21)14-10-4-2-3-5-11(10)19-20-14/h2-8H,1H3,(H,17,21)(H,19,20) |
| InChIKey | KVFPHBXYORAUGE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |