C12H16N2O2S2 — CID 55233662
N-(2,2-dimethoxyethyl)-2-methylsulfanyl-1,3-benzothiazol-6-amine (PubChem CID 55233662) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-methylsulfanyl-1,3-benzothiazol-6-amine.
| Compound Name | N-(2,2-dimethoxyethyl)-2-methylsulfanyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 55233662 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-methylsulfanyl-1,3-benzothiazol-6-amine |
| SMILES | COC(CNc1ccc2nc(SC)sc2c1)OC |
| InChI | InChI=1S/C12H16N2O2S2/c1-15-11(16-2)7-13-8-4-5-9-10(6-8)18-12(14-9)17-3/h4-6,11,13H,7H2,1-3H3 |
| InChIKey | DYNFJPFEWJJSJC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|