C13H18N2S2 — CID 43228519
2-methylsulfanyl-N-pentyl-1,3-benzothiazol-6-amine (PubChem CID 43228519) has the molecular formula C13H18N2S2 and a molecular weight of 266.44 g/mol. Its IUPAC name is 2-methylsulfanyl-N-pentyl-1,3-benzothiazol-6-amine.
| Compound Name | 2-methylsulfanyl-N-pentyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 43228519 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-methylsulfanyl-N-pentyl-1,3-benzothiazol-6-amine |
| SMILES | CCCCCNc1ccc2nc(SC)sc2c1 |
| InChI | InChI=1S/C13H18N2S2/c1-3-4-5-8-14-10-6-7-11-12(9-10)17-13(15-11)16-2/h6-7,9,14H,3-5,8H2,1-2H3 |
| InChIKey | HIUILRHQVYZXCQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|