C16H24N2S — CID 43682586
2-methyl-N-octyl-1,3-benzothiazol-6-amine (PubChem CID 43682586) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 2-methyl-N-octyl-1,3-benzothiazol-6-amine.
| Compound Name | 2-methyl-N-octyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 43682586 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-methyl-N-octyl-1,3-benzothiazol-6-amine |
| SMILES | CCCCCCCCNc1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C16H24N2S/c1-3-4-5-6-7-8-11-17-14-9-10-15-16(12-14)19-13(2)18-15/h9-10,12,17H,3-8,11H2,1-2H3 |
| InChIKey | XNVTXNZGENHNLH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|