C11H14N2S — CID 82672114
2-methyl-N-propyl-1,3-benzothiazol-5-amine (PubChem CID 82672114) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-methyl-N-propyl-1,3-benzothiazol-5-amine.
| Compound Name | 2-methyl-N-propyl-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 82672114 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 2-methyl-N-propyl-1,3-benzothiazol-5-amine |
| SMILES | CCCNc1ccc2sc(C)nc2c1 |
| InChI | InChI=1S/C11H14N2S/c1-3-6-12-9-4-5-11-10(7-9)13-8(2)14-11/h4-5,7,12H,3,6H2,1-2H3 |
| InChIKey | FSQHVFVICQZJFO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |