C16H18N2O4S — CID 58678039
diethyl 2-[[(2-methyl-1,3-benzothiazol-5-yl)amino]methylidene]propanedioate (PubChem CID 58678039) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is diethyl 2-[[(2-methyl-1,3-benzothiazol-5-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(2-methyl-1,3-benzothiazol-5-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 58678039 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | diethyl 2-[[(2-methyl-1,3-benzothiazol-5-yl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1ccc2sc(C)nc2c1)C(=O)OCC |
| InChI | InChI=1S/C16H18N2O4S/c1-4-21-15(19)12(16(20)22-5-2)9-17-11-6-7-14-13(8-11)18-10(3)23-14/h6-9,17H,4-5H2,1-3H3 |
| InChIKey | MWKVUXHJZSAQTN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|