C16H15F3N2O4S — CID 172703933
diethyl 2-[[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]methylidene]propanedioate (PubChem CID 172703933) has the molecular formula C16H15F3N2O4S and a molecular weight of 388.37 g/mol. Its IUPAC name is diethyl 2-[[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 172703933 |
| Molecular Formula | C16H15F3N2O4S |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | diethyl 2-[[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1nc2cc(C(F)(F)F)ccc2s1)C(=O)OCC |
| InChI | InChI=1S/C16H15F3N2O4S/c1-3-24-13(22)10(14(23)25-4-2)8-20-15-21-11-7-9(16(17,18)19)5-6-12(11)26-15/h5-8H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | DIESYORGZUVDCH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|