C13H15F3N2OS — CID 133342940
1-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]pentan-2-ol (PubChem CID 133342940) has the molecular formula C13H15F3N2OS and a molecular weight of 304.34 g/mol. Its IUPAC name is 1-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]pentan-2-ol.
| Compound Name | 1-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 133342940 |
| Molecular Formula | C13H15F3N2OS |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]amino]pentan-2-ol |
| SMILES | CCCC(O)CNc1nc2cc(C(F)(F)F)ccc2s1 |
| InChI | InChI=1S/C13H15F3N2OS/c1-2-3-9(19)7-17-12-18-10-6-8(13(14,15)16)4-5-11(10)20-12/h4-6,9,19H,2-3,7H2,1H3,(H,17,18) |
| InChIKey | RJUONRGPGPBKRA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |