C15H15ClN2O4S — CID 165344061
diethyl 2-[[(4-chloro-1,3-benzothiazol-2-yl)amino]methylidene]propanedioate (PubChem CID 165344061) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is diethyl 2-[[(4-chloro-1,3-benzothiazol-2-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(4-chloro-1,3-benzothiazol-2-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 165344061 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | diethyl 2-[[(4-chloro-1,3-benzothiazol-2-yl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1nc2c(Cl)cccc2s1)C(=O)OCC |
| InChI | InChI=1S/C15H15ClN2O4S/c1-3-21-13(19)9(14(20)22-4-2)8-17-15-18-12-10(16)6-5-7-11(12)23-15/h5-8H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | MENUAJXVVLSXRR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|