C14H9Cl2N3OS — CID 46193181
1-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)urea (PubChem CID 46193181) has the molecular formula C14H9Cl2N3OS and a molecular weight of 338.22 g/mol. Its IUPAC name is 1-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)urea.
| Compound Name | 1-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)urea |
|---|---|
| PubChem CID | 46193181 |
| Molecular Formula | C14H9Cl2N3OS |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 1-(4-chloro-1,3-benzothiazol-2-yl)-3-(2-chlorophenyl)urea |
| SMILES | O=C(Nc1nc2c(Cl)cccc2s1)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H9Cl2N3OS/c15-8-4-1-2-6-10(8)17-13(20)19-14-18-12-9(16)5-3-7-11(12)21-14/h1-7H,(H2,17,18,19,20) |
| InChIKey | GIHYLXDQQHCUEU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |