C16H14FN3OS — CID 121082547
1-(4-ethyl-1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)urea (PubChem CID 121082547) has the molecular formula C16H14FN3OS and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-(4-ethyl-1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)urea.
| Compound Name | 1-(4-ethyl-1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 121082547 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-(4-ethyl-1,3-benzothiazol-2-yl)-3-(2-fluorophenyl)urea |
| SMILES | CCc1cccc2sc(NC(=O)Nc3ccccc3F)nc12 |
| InChI | InChI=1S/C16H14FN3OS/c1-2-10-6-5-9-13-14(10)19-16(22-13)20-15(21)18-12-8-4-3-7-11(12)17/h3-9H,2H2,1H3,(H2,18,19,20,21) |
| InChIKey | FNUYZDRPESIQSI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |