C14H13N3OS2 — CID 121082548
1-(4-ethyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea (PubChem CID 121082548) has the molecular formula C14H13N3OS2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(4-ethyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea.
| Compound Name | 1-(4-ethyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 121082548 |
| Molecular Formula | C14H13N3OS2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 1-(4-ethyl-1,3-benzothiazol-2-yl)-3-thiophen-2-ylurea |
| SMILES | CCc1cccc2sc(NC(=O)Nc3cccs3)nc12 |
| InChI | InChI=1S/C14H13N3OS2/c1-2-9-5-3-6-10-12(9)16-14(20-10)17-13(18)15-11-7-4-8-19-11/h3-8H,2H2,1H3,(H2,15,16,17,18) |
| InChIKey | VBOKEQJNYKFHPP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |