C10H11N3OS2 — CID 110706893
1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-thiophen-2-ylurea (PubChem CID 110706893) has the molecular formula C10H11N3OS2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-thiophen-2-ylurea.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-thiophen-2-ylurea |
|---|---|
| PubChem CID | 110706893 |
| Molecular Formula | C10H11N3OS2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-thiophen-2-ylurea |
| SMILES | Cc1nc(NC(=O)Nc2cccs2)sc1C |
| InChI | InChI=1S/C10H11N3OS2/c1-6-7(2)16-10(11-6)13-9(14)12-8-4-3-5-15-8/h3-5H,1-2H3,(H2,11,12,13,14) |
| InChIKey | RDBFBAXWGVNMHJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |