C14H15N3OS — CID 108903306
1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-[(E)-2-phenylethenyl]urea (PubChem CID 108903306) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-[(E)-2-phenylethenyl]urea.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-[(E)-2-phenylethenyl]urea |
|---|---|
| PubChem CID | 108903306 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-3-[(E)-2-phenylethenyl]urea |
| SMILES | Cc1nc(NC(=O)N/C=C/c2ccccc2)sc1C |
| InChI | InChI=1S/C14H15N3OS/c1-10-11(2)19-14(16-10)17-13(18)15-9-8-12-6-4-3-5-7-12/h3-9H,1-2H3,(H2,15,16,17,18)/b9-8+ |
| InChIKey | ZBYCVGFEYPVYDS-CMDGGOBGSA-N |
| XLogP | 3.55 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |