About 2-phenylethenylcarbamic acid
2-phenylethenylcarbamic acid (PubChem CID 151881054) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-phenylethenylcarbamic acid.
Molecular Properties
| Compound Name | 2-phenylethenylcarbamic acid |
| PubChem CID | 151881054 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 2-phenylethenylcarbamic acid |
| SMILES | O=C(O)NC=Cc1ccccc1 |
| InChI | InChI=1S/C9H9NO2/c11-9(12)10-7-6-8-4-2-1-3-5-8/h1-7,10H,(H,11,12) |
| InChIKey | SOSMVMHMPJGXIS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylethenylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethenylcarbamic acid?
The IUPAC name of 2-phenylethenylcarbamic acid (CID 151881054) is 2-phenylethenylcarbamic acid.
What is the SMILES notation for 2-phenylethenylcarbamic acid?
The canonical SMILES for 2-phenylethenylcarbamic acid is O=C(O)NC=Cc1ccccc1.
What is the InChIKey of 2-phenylethenylcarbamic acid?
The InChIKey is SOSMVMHMPJGXIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c11-9(12)10-7-6-8-4-2-1-3-5-8/h1-7,10H,(H,11,12).
What are the key properties of 2-phenylethenylcarbamic acid?
2-phenylethenylcarbamic acid has a molecular weight of 163.18 g/mol, XLogP of 1.92, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethenylcarbamic acid is sourced from PubChem (CID 151881054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).