2-phenylethenylcarbamic acid

C9H9NO2 — CID 151881054

IUPAC2-phenylethenylcarbamic acid
SMILESO=C(O)NC=Cc1ccccc1
InChIInChI=1S/C9H9NO2/c11-9(12)10-7-6-8-4-2-1-3-5-8/h1-7,10H,(H,11,12)
InChIKeySOSMVMHMPJGXIS-UHFFFAOYSA-N
MW163.18 g/mol
LogP1.92
Rot. Bonds2

About 2-phenylethenylcarbamic acid

2-phenylethenylcarbamic acid (PubChem CID 151881054) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-phenylethenylcarbamic acid.

Molecular Properties

Compound Name2-phenylethenylcarbamic acid
PubChem CID151881054
Molecular FormulaC9H9NO2
Molecular Weight163.18 g/mol
Exact Mass163.06
IUPAC Name2-phenylethenylcarbamic acid
SMILESO=C(O)NC=Cc1ccccc1
InChIInChI=1S/C9H9NO2/c11-9(12)10-7-6-8-4-2-1-3-5-8/h1-7,10H,(H,11,12)
InChIKeySOSMVMHMPJGXIS-UHFFFAOYSA-N
XLogP1.92
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.18
LogP ≤ 51.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze 2-phenylethenylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenylethenylcarbamic acid?
The IUPAC name of 2-phenylethenylcarbamic acid (CID 151881054) is 2-phenylethenylcarbamic acid.
What is the SMILES notation for 2-phenylethenylcarbamic acid?
The canonical SMILES for 2-phenylethenylcarbamic acid is O=C(O)NC=Cc1ccccc1.
What is the InChIKey of 2-phenylethenylcarbamic acid?
The InChIKey is SOSMVMHMPJGXIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c11-9(12)10-7-6-8-4-2-1-3-5-8/h1-7,10H,(H,11,12).
What are the key properties of 2-phenylethenylcarbamic acid?
2-phenylethenylcarbamic acid has a molecular weight of 163.18 g/mol, XLogP of 1.92, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethenylcarbamic acid is sourced from PubChem (CID 151881054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).