C17H15NO2 — CID 135914517
(2S,3S)-3-phenyl-N-[(Z)-2-phenylethenyl]oxirane-2-carboxamide (PubChem CID 135914517) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2S,3S)-3-phenyl-N-[(Z)-2-phenylethenyl]oxirane-2-carboxamide.
| Compound Name | (2S,3S)-3-phenyl-N-[(Z)-2-phenylethenyl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 135914517 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (2S,3S)-3-phenyl-N-[(Z)-2-phenylethenyl]oxirane-2-carboxamide |
| SMILES | O=C(N/C=C\c1ccccc1)[C@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c19-17(18-12-11-13-7-3-1-4-8-13)16-15(20-16)14-9-5-2-6-10-14/h1-12,15-16H,(H,18,19)/b12-11-/t15-,16-/m0/s1 |
| InChIKey | FXXAQFAYRCXZDE-KNBCMTEUSA-N |
| XLogP | 2.91 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|