C15H13NO3 — CID 45086957
(2R,3S)-N-(2-hydroxyphenyl)-3-phenyloxirane-2-carboxamide (PubChem CID 45086957) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is (2R,3S)-N-(2-hydroxyphenyl)-3-phenyloxirane-2-carboxamide.
| Compound Name | (2R,3S)-N-(2-hydroxyphenyl)-3-phenyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 45086957 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | (2R,3S)-N-(2-hydroxyphenyl)-3-phenyloxirane-2-carboxamide |
| SMILES | O=C(Nc1ccccc1O)[C@@H]1O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H13NO3/c17-12-9-5-4-8-11(12)16-15(18)14-13(19-14)10-6-2-1-3-7-10/h1-9,13-14,17H,(H,16,18)/t13-,14+/m0/s1 |
| InChIKey | VAPREBOMBAXIJR-UONOGXRCSA-N |
| XLogP | 2.47 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|