C15H12ClNO2 — CID 139078040
(2R,3R)-3-(3-chlorophenyl)-N-phenyloxirane-2-carboxamide (PubChem CID 139078040) has the molecular formula C15H12ClNO2 and a molecular weight of 273.72 g/mol. Its IUPAC name is (2R,3R)-3-(3-chlorophenyl)-N-phenyloxirane-2-carboxamide.
| Compound Name | (2R,3R)-3-(3-chlorophenyl)-N-phenyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 139078040 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (2R,3R)-3-(3-chlorophenyl)-N-phenyloxirane-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@H]1O[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClNO2/c16-11-6-4-5-10(9-11)13-14(19-13)15(18)17-12-7-2-1-3-8-12/h1-9,13-14H,(H,17,18)/t13-,14-/m1/s1 |
| InChIKey | BPQBDNKAMDQUMZ-ZIAGYGMSSA-N |
| XLogP | 3.42 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|