C16H15ClN2OS — CID 7409403
(2S)-2-(3-chlorophenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide (PubChem CID 7409403) has the molecular formula C16H15ClN2OS and a molecular weight of 318.83 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide.
| Compound Name | (2S)-2-(3-chlorophenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 7409403 |
| Molecular Formula | C16H15ClN2OS |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (2S)-2-(3-chlorophenyl)-N-phenyl-1,3-thiazolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCS[C@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClN2OS/c17-13-6-4-5-12(11-13)15-19(9-10-21-15)16(20)18-14-7-2-1-3-8-14/h1-8,11,15H,9-10H2,(H,18,20)/t15-/m0/s1 |
| InChIKey | FJTHBGHVZYTAPH-HNNXBMFYSA-N |
| XLogP | 4.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |