C16H21ClN2OS — CID 4142914
2-(3-chlorophenyl)-N-cyclohexyl-1,3-thiazolidine-3-carboxamide (PubChem CID 4142914) has the molecular formula C16H21ClN2OS and a molecular weight of 324.88 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-cyclohexyl-1,3-thiazolidine-3-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-cyclohexyl-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 4142914 |
| Molecular Formula | C16H21ClN2OS |
| Molecular Weight | 324.88 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-(3-chlorophenyl)-N-cyclohexyl-1,3-thiazolidine-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCSC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2OS/c17-13-6-4-5-12(11-13)15-19(9-10-21-15)16(20)18-14-7-2-1-3-8-14/h4-6,11,14-15H,1-3,7-10H2,(H,18,20) |
| InChIKey | LUCKDCCDPYSPNR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.88 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |