C11H11Cl2NOS — CID 7326995
2-chloro-1-[(2R)-2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 7326995) has the molecular formula C11H11Cl2NOS and a molecular weight of 276.19 g/mol. Its IUPAC name is 2-chloro-1-[(2R)-2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 2-chloro-1-[(2R)-2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 7326995 |
| Molecular Formula | C11H11Cl2NOS |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 2-chloro-1-[(2R)-2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | O=C(CCl)N1CCS[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NOS/c12-7-10(15)14-4-5-16-11(14)8-2-1-3-9(13)6-8/h1-3,6,11H,4-5,7H2/t11-/m1/s1 |
| InChIKey | DLDLKRCPJXWWAL-LLVKDONJSA-N |
| XLogP | 3.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|