C14H12ClN3OS — CID 122331182
[2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-pyrazin-2-ylmethanone (PubChem CID 122331182) has the molecular formula C14H12ClN3OS and a molecular weight of 305.79 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-pyrazin-2-ylmethanone.
| Compound Name | [2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 122331182 |
| Molecular Formula | C14H12ClN3OS |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | [2-(3-chlorophenyl)-1,3-thiazolidin-3-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCSC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H12ClN3OS/c15-11-3-1-2-10(8-11)14-18(6-7-20-14)13(19)12-9-16-4-5-17-12/h1-5,8-9,14H,6-7H2 |
| InChIKey | ANVJEWFVDRVVAQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |