C15H17Cl3N4O — CID 120802029
[2-(3-chlorophenyl)piperazin-1-yl]-pyrazin-2-ylmethanone;dihydrochloride (PubChem CID 120802029) has the molecular formula C15H17Cl3N4O and a molecular weight of 375.69 g/mol. Its IUPAC name is [2-(3-chlorophenyl)piperazin-1-yl]-pyrazin-2-ylmethanone;dihydrochloride.
| Compound Name | [2-(3-chlorophenyl)piperazin-1-yl]-pyrazin-2-ylmethanone;dihydrochloride |
|---|---|
| PubChem CID | 120802029 |
| Molecular Formula | C15H17Cl3N4O |
| Molecular Weight | 375.69 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | [2-(3-chlorophenyl)piperazin-1-yl]-pyrazin-2-ylmethanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1cnccn1)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H15ClN4O.2ClH/c16-12-3-1-2-11(8-12)14-10-18-6-7-20(14)15(21)13-9-17-4-5-19-13;;/h1-5,8-9,14,18H,6-7,10H2;2*1H |
| InChIKey | FZIZYSJXALVOFU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |