C16H19Cl2N3O — CID 120802183
[2-(3-chlorophenyl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride (PubChem CID 120802183) has the molecular formula C16H19Cl2N3O and a molecular weight of 340.25 g/mol. Its IUPAC name is [2-(3-chlorophenyl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride.
| Compound Name | [2-(3-chlorophenyl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120802183 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | [2-(3-chlorophenyl)piperazin-1-yl]-(1-methylpyrrol-2-yl)methanone;hydrochloride |
| SMILES | Cl.Cn1cccc1C(=O)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H18ClN3O.ClH/c1-19-8-3-6-14(19)16(21)20-9-7-18-11-15(20)12-4-2-5-13(17)10-12;/h2-6,8,10,15,18H,7,9,11H2,1H3;1H |
| InChIKey | AQKJWWKQKXDOHR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |