C16H17ClN4O3 — CID 120802342
5-[2-(3-chlorophenyl)piperazine-1-carbonyl]-1-methylpyrimidine-2,4-dione (PubChem CID 120802342) has the molecular formula C16H17ClN4O3 and a molecular weight of 348.79 g/mol. Its IUPAC name is 5-[2-(3-chlorophenyl)piperazine-1-carbonyl]-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-[2-(3-chlorophenyl)piperazine-1-carbonyl]-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 120802342 |
| Molecular Formula | C16H17ClN4O3 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 5-[2-(3-chlorophenyl)piperazine-1-carbonyl]-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1cc(C(=O)N2CCNCC2c2cccc(Cl)c2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H17ClN4O3/c1-20-9-12(14(22)19-16(20)24)15(23)21-6-5-18-8-13(21)10-3-2-4-11(17)7-10/h2-4,7,9,13,18H,5-6,8H2,1H3,(H,19,22,24) |
| InChIKey | WEXQMDYUXUOPCP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |