C15H19Cl2N5O — CID 120728916
(5-methylpyrazin-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 120728916) has the molecular formula C15H19Cl2N5O and a molecular weight of 356.26 g/mol. Its IUPAC name is (5-methylpyrazin-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | (5-methylpyrazin-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 120728916 |
| Molecular Formula | C15H19Cl2N5O |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (5-methylpyrazin-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | Cc1cnc(C(=O)N2CCNCC2c2cccnc2)cn1.Cl.Cl |
| InChI | InChI=1S/C15H17N5O.2ClH/c1-11-7-19-13(9-18-11)15(21)20-6-5-17-10-14(20)12-3-2-4-16-8-12;;/h2-4,7-9,14,17H,5-6,10H2,1H3;2*1H |
| InChIKey | LADZXGYRAGMFED-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |