C15H18ClN3O2 — CID 120732206
(5-methylfuran-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 120732206) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is (5-methylfuran-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (5-methylfuran-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120732206 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (5-methylfuran-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | Cc1ccc(C(=O)N2CCNCC2c2cccnc2)o1.Cl |
| InChI | InChI=1S/C15H17N3O2.ClH/c1-11-4-5-14(20-11)15(19)18-8-7-17-10-13(18)12-3-2-6-16-9-12;/h2-6,9,13,17H,7-8,10H2,1H3;1H |
| InChIKey | DPYDEZNVBBRCIS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |