C15H18ClN3O4S — CID 120730947
(5-methylsulfonylfuran-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 120730947) has the molecular formula C15H18ClN3O4S and a molecular weight of 371.85 g/mol. Its IUPAC name is (5-methylsulfonylfuran-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (5-methylsulfonylfuran-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120730947 |
| Molecular Formula | C15H18ClN3O4S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | (5-methylsulfonylfuran-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N2CCNCC2c2cccnc2)o1.Cl |
| InChI | InChI=1S/C15H17N3O4S.ClH/c1-23(20,21)14-5-4-13(22-14)15(19)18-8-7-17-10-12(18)11-3-2-6-16-9-11;/h2-6,9,12,17H,7-8,10H2,1H3;1H |
| InChIKey | LHYGEBHMFZWBBS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |