C14H17ClN4O — CID 120730091
(2-pyridin-3-ylpiperazin-1-yl)-(1H-pyrrol-2-yl)methanone;hydrochloride (PubChem CID 120730091) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is (2-pyridin-3-ylpiperazin-1-yl)-(1H-pyrrol-2-yl)methanone;hydrochloride.
| Compound Name | (2-pyridin-3-ylpiperazin-1-yl)-(1H-pyrrol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120730091 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (2-pyridin-3-ylpiperazin-1-yl)-(1H-pyrrol-2-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc[nH]1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C14H16N4O.ClH/c19-14(12-4-2-6-17-12)18-8-7-16-10-13(18)11-3-1-5-15-9-11;/h1-6,9,13,16-17H,7-8,10H2;1H |
| InChIKey | RGJBYJUSVYGVOD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |