C15H15ClN4O — CID 120730350
(3-chloro-4-pyridinyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone (PubChem CID 120730350) has the molecular formula C15H15ClN4O and a molecular weight of 302.76 g/mol. Its IUPAC name is (3-chloro-4-pyridinyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone.
| Compound Name | (3-chloro-4-pyridinyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 120730350 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (3-chloro-4-pyridinyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccncc1Cl)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C15H15ClN4O/c16-13-9-18-5-3-12(13)15(21)20-7-6-19-10-14(20)11-2-1-4-17-8-11/h1-5,8-9,14,19H,6-7,10H2 |
| InChIKey | ARROZSCDOHUEEX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |