C16H16Cl2FN3O — CID 120731063
(3-chloro-5-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 120731063) has the molecular formula C16H16Cl2FN3O and a molecular weight of 356.23 g/mol. Its IUPAC name is (3-chloro-5-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (3-chloro-5-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120731063 |
| Molecular Formula | C16H16Cl2FN3O |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | (3-chloro-5-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cc(F)cc(Cl)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C16H15ClFN3O.ClH/c17-13-6-12(7-14(18)8-13)16(22)21-5-4-20-10-15(21)11-2-1-3-19-9-11;/h1-3,6-9,15,20H,4-5,10H2;1H |
| InChIKey | XKJVCRHKQAMLBQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |