C16H16BrClFN3O — CID 120732014
(4-bromo-3-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 120732014) has the molecular formula C16H16BrClFN3O and a molecular weight of 400.68 g/mol. Its IUPAC name is (4-bromo-3-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | (4-bromo-3-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120732014 |
| Molecular Formula | C16H16BrClFN3O |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (4-bromo-3-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccc(Br)c(F)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C16H15BrFN3O.ClH/c17-13-4-3-11(8-14(13)18)16(22)21-7-6-20-10-15(21)12-2-1-5-19-9-12;/h1-5,8-9,15,20H,6-7,10H2;1H |
| InChIKey | MTKIRIJRNCABGE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |