C17H20N4O3S — CID 120729515
[3-(2-pyridin-3-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide (PubChem CID 120729515) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is [3-(2-pyridin-3-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide.
| Compound Name | [3-(2-pyridin-3-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 120729515 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [3-(2-pyridin-3-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide |
| SMILES | NS(=O)(=O)Cc1cccc(C(=O)N2CCNCC2c2cccnc2)c1 |
| InChI | InChI=1S/C17H20N4O3S/c18-25(23,24)12-13-3-1-4-14(9-13)17(22)21-8-7-20-11-16(21)15-5-2-6-19-10-15/h1-6,9-10,16,20H,7-8,11-12H2,(H2,18,23,24) |
| InChIKey | OBZZWYTXLVEZPN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |