C17H18BrN3O — CID 120730620
(3-bromo-4-methylphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone (PubChem CID 120730620) has the molecular formula C17H18BrN3O and a molecular weight of 360.26 g/mol. Its IUPAC name is (3-bromo-4-methylphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone.
| Compound Name | (3-bromo-4-methylphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 120730620 |
| Molecular Formula | C17H18BrN3O |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (3-bromo-4-methylphenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCNCC2c2cccnc2)cc1Br |
| InChI | InChI=1S/C17H18BrN3O/c1-12-4-5-13(9-15(12)18)17(22)21-8-7-20-11-16(21)14-3-2-6-19-10-14/h2-6,9-10,16,20H,7-8,11H2,1H3 |
| InChIKey | HXFKXDBCOPPRCR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |