C18H22N4O3S — CID 120732089
N-[2-methyl-5-(2-pyridin-3-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide (PubChem CID 120732089) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[2-methyl-5-(2-pyridin-3-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide.
| Compound Name | N-[2-methyl-5-(2-pyridin-3-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 120732089 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[2-methyl-5-(2-pyridin-3-ylpiperazine-1-carbonyl)phenyl]methanesulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCNCC2c2cccnc2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C18H22N4O3S/c1-13-5-6-14(10-16(13)21-26(2,24)25)18(23)22-9-8-20-12-17(22)15-4-3-7-19-11-15/h3-7,10-11,17,20-21H,8-9,12H2,1-2H3 |
| InChIKey | BPJNNQDPSMDXME-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |