C16H15BrFN3O — CID 120729585
(3-bromo-4-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone (PubChem CID 120729585) has the molecular formula C16H15BrFN3O and a molecular weight of 364.22 g/mol. Its IUPAC name is (3-bromo-4-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone.
| Compound Name | (3-bromo-4-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 120729585 |
| Molecular Formula | C16H15BrFN3O |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | (3-bromo-4-fluorophenyl)-(2-pyridin-3-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc(F)c(Br)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C16H15BrFN3O/c17-13-8-11(3-4-14(13)18)16(22)21-7-6-20-10-15(21)12-2-1-5-19-9-12/h1-5,8-9,15,20H,6-7,10H2 |
| InChIKey | HMBNGFPERJMYGM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |