C14H14BrN3OS — CID 120731046
(4-bromothiophen-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone (PubChem CID 120731046) has the molecular formula C14H14BrN3OS and a molecular weight of 352.26 g/mol. Its IUPAC name is (4-bromothiophen-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone.
| Compound Name | (4-bromothiophen-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 120731046 |
| Molecular Formula | C14H14BrN3OS |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | (4-bromothiophen-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cc(Br)cs1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C14H14BrN3OS/c15-11-6-13(20-9-11)14(19)18-5-4-17-8-12(18)10-2-1-3-16-7-10/h1-3,6-7,9,12,17H,4-5,8H2 |
| InChIKey | PUDUZYBEIMYYEL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |