C15H17ClF2N2O — CID 120802294
[2-(3-chlorophenyl)piperazin-1-yl]-(3,3-difluorocyclobutyl)methanone (PubChem CID 120802294) has the molecular formula C15H17ClF2N2O and a molecular weight of 314.76 g/mol. Its IUPAC name is [2-(3-chlorophenyl)piperazin-1-yl]-(3,3-difluorocyclobutyl)methanone.
| Compound Name | [2-(3-chlorophenyl)piperazin-1-yl]-(3,3-difluorocyclobutyl)methanone |
|---|---|
| PubChem CID | 120802294 |
| Molecular Formula | C15H17ClF2N2O |
| Molecular Weight | 314.76 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | [2-(3-chlorophenyl)piperazin-1-yl]-(3,3-difluorocyclobutyl)methanone |
| SMILES | O=C(C1CC(F)(F)C1)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H17ClF2N2O/c16-12-3-1-2-10(6-12)13-9-19-4-5-20(13)14(21)11-7-15(17,18)8-11/h1-3,6,11,13,19H,4-5,7-9H2 |
| InChIKey | MXKHVGFNMROEDP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.76 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |