C18H23ClN2O — CID 120803541
7-bicyclo[4.1.0]heptanyl-[2-(3-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 120803541) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is 7-bicyclo[4.1.0]heptanyl-[2-(3-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | 7-bicyclo[4.1.0]heptanyl-[2-(3-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120803541 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 7-bicyclo[4.1.0]heptanyl-[2-(3-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1C2CCCCC21)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H23ClN2O/c19-13-5-3-4-12(10-13)16-11-20-8-9-21(16)18(22)17-14-6-1-2-7-15(14)17/h3-5,10,14-17,20H,1-2,6-9,11H2 |
| InChIKey | RMEVTHSAEYHWDQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |